1-Naphthyl isothiocyanate is a chemical compound which is an isothiocyanate derivative of naphthalene. It can be produced by the reaction of 1-Naphthylthiourea and chlorobenzene.[2]
Quick facts Names, Identifiers ...
1-Naphthyl isothiocyanate
Skeletal formula of 1-naphthyl isothiocyanate |
| Names |
Preferred IUPAC name
1-Isothiocyanatonaphthalene [1] |
| Other names
1-Naphthylisothiocyanate; α-Naphthyl isothiocyanate; Kesscocide |
| Identifiers |
|
|
|
|
| Abbreviations |
ANIT |
|
637868 |
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| ECHA InfoCard |
100.008.174 |
| EC Number |
|
| MeSH |
1-Naphthylisothiocyanate |
|
|
| RTECS number |
|
| UNII |
|
| UN number |
2811 |
|
|
InChI=1S/C11H7NS/c13-8-12-11-7-3-5-9-4-1-2-6-10(9)11/h1-7H Y Key: JBDOSUUXMYMWQH-UHFFFAOYSA-N Y InChI=1/C11H7NS/c13-8-12-11-7-3-5-9-4-1-2-6-10(9)11/h1-7H Key: JBDOSUUXMYMWQH-UHFFFAOYAA
|
S=C=Nc1cccc2ccccc12 S=C=NC1=CC=CC2=CC=CC=C12
|
| Properties |
|
C11H7NS |
| Molar mass |
185.24 g·mol−1 |
| Melting point |
55 to 57 °C (131 to 135 °F; 328 to 330 K) |
| Hazards |
| GHS labelling: |
|
 |
|
Danger |
|
H301, H312, H315, H319, H332, H334, H335 |
|
P261, P280, P301+P310, P305+P351+P338, P342+P311 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close