2-Oxoadipic acid, also known as α-ketoadipic acid, is an intermediate in the metabolism of lysine and tryptophan.[3][4] The conjugate base and carboxylate is 2-oxoadipate or α-ketoadipate, which is the biochemically relevant form.
Quick Facts Names, Identifiers ...
2-Oxoadipic acid[1]
 Skeletal formula of α-ketoadipic acid |
 Ball and stick model of α-ketoadipic acid |
|
| Names |
| Preferred IUPAC name
|
| Other names
α-Ketoadipic acid
2-Ketoadipic acid
α-Oxoadipic acid |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
| ECHA InfoCard |
100.164.320 |
|
|
| KEGG |
|
| MeSH |
Alpha-ketoadipic+acid |
|
|
| UNII |
|
|
|
InChI=1S/C6H8O5/c7-4(6(10)11)2-1-3-5(8)9/h1-3H2,(H,8,9)(H,10,11) Y Key: FGSBNBBHOZHUBO-UHFFFAOYSA-N Y InChI=1/C6H8O5/c7-4(6(10)11)2-1-3-5(8)9/h1-3H2,(H,8,9)(H,10,11) Key: FGSBNBBHOZHUBO-UHFFFAOYAU
|
C(CC(=O)C(=O)O)CC(=O)O O=C(C(=O)O)CCCC(=O)O
|
| Properties |
|
C6H8O5 |
| Molar mass |
160.125 g·mol−1 |
| Density |
1.4 g cm−3 |
| Melting point |
125 °C (257 °F; 398 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
