2-Pentanone or methyl propyl ketone (MPK) is a ketone and solvent of minor importance. It is comparable to methyl ethyl ketone, but has a lower solvency and is more expensive.[5] It occurs naturally in Nicotiana tabacum (Tobacco)[6] and blue cheese as a metabolic product of Penicillium mold growth.[7]
Quick Facts Names, Identifiers ...
2-Pentanone
Skeletal formula of 2-pentanone |
Ball-and-stick model of 2-pentanone |
Names |
Preferred IUPAC name
|
Other names
methyl propyl ketone 2-pentanone MPK |
Identifiers |
|
|
|
|
ChEBI |
|
ChEMBL |
|
ChemSpider |
|
ECHA InfoCard |
100.003.208 |
KEGG |
|
|
|
RTECS number |
|
UNII |
|
|
|
InChI=1S/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3 Y Key: XNLICIUVMPYHGG-UHFFFAOYSA-N Y InChI=1/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3 Key: XNLICIUVMPYHGG-UHFFFAOYAJ
|
|
Properties |
|
C5H10O |
Molar mass |
86.13 g/mol |
Appearance |
Colorless liquid |
Odor |
resembling acetone |
Density |
0.8062 g/ml (20 °C) [1] |
Melting point |
−78 °C (−108 °F; 195 K) |
Boiling point |
102[2][1] °C (216 °F; 375 K) |
|
6% (20°C)[3] |
Vapor pressure |
3.6 kPa (20 °C) |
|
−57.41·10−6 cm3/mol |
|
1.3903 (20 °C) [1] |
Viscosity |
0.50 mPa·s (20 °C) |
Hazards |
Flash point |
10 °C (50 °F; 283 K) |
Explosive limits |
1.5–8.2%[3] |
Lethal dose or concentration (LD, LC): |
|
1600 mg/kg (rat, oral) 1600 mg/kg (mouse, oral)[4] |
|
50,000 ppm (guinea pig, 50 min) 13,000 ppm (guinea pig, 5 hr)[4] |
NIOSH (US health exposure limits): |
|
TWA 200 ppm (700 mg/m3)[3] |
|
TWA 150 ppm (530 mg/m3)[3] |
|
1500 ppm[3] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close