3-Methyl-2-pentanone (methyl sec-butyl ketone) is an aliphatic ketone and isomer of 2-hexanone.[2]

Quick facts Names, Identifiers ...
3-Methyl-2-pentanone
 |
| Names |
| Preferred IUPAC name
|
| Other names
Methyl sec-Butyl ketone |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
| ECHA InfoCard |
100.008.439 |
| EC Number |
|
|
|
|
|
InChI=1S/C6H12O/c1-4-5(2)6(3)7/h5H,4H2,1-3H3 Key: UIHCLUNTQKBZGK-UHFFFAOYSA-N InChI=1/C6H12O/c1-4-5(2)6(3)7/h5H,4H2,1-3H3 Key: UIHCLUNTQKBZGK-UHFFFAOYAL
|
|
| Properties |
|
C6H12O |
| Molar mass |
100.161 g·mol−1 |
| Appearance |
Colorless liquid |
| Odor |
Peppermint-like |
| Density |
0.8130 g/mL (20 °C) |
| Melting point |
−83 °C (−117 °F; 190 K) |
| Boiling point |
116 °C (241 °F; 389 K) |
|
2.26 wt % (20 °C) |
|
1.4012 (20 °C) |
| Hazards |
| GHS labelling:[1] |
|
 |
|
Danger |
|
H225 |
|
P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P370+P378, P403+P235, P501 |
| Flash point |
12 °C (54 °F; 285 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close