3-Hydroxy picolinic acid is a picolinic acid derivative and is a member of the pyridine family. It is used as a matrix for nucleotides in MALDI mass spectrometry analyses[1] and the synthesis of favipiravir.
Quick Facts Names, Identifiers ...
3-Hydroxypicolinic acid
 |
 |
| Names |
Preferred IUPAC name
3-Hydroxypyridine-2-carboxylic acid |
| Other names
3-Hydroxypicolinic acid
3-Hydroxy-2-pyridinecarboxylic acid |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
| ECHA InfoCard |
100.011.690 |
|
|
| UNII |
|
|
|
InChI=1S/C6H5NO3/c8-4-2-1-3-7-5(4)6(9)10/h1-3,8H,(H,9,10) Y Key: BRARRAHGNDUELT-UHFFFAOYSA-N Y InChI=1/C6H5NO3/c8-4-2-1-3-7-5(4)6(9)10/h1-3,8H,(H,9,10) Key: BRARRAHGNDUELT-UHFFFAOYAC
|
C1=CC(=C(N=C1)C(=O)O)O c1cc(c(nc1)C(=O)O)O
|
| Properties |
|
C6H5NO3 |
| Molar mass |
139.109 |
| Appearance |
Light yellow needles |
| Melting point |
208 to 212 °C (406 to 414 °F; 481 to 485 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
