Homovanillyl alcohol is a metabolite of hydroxytyrosol, which in turn is a metabolite of the neurotransmitter dopamine.
Quick facts Names, Identifiers ...
Homovanillyl alcohol[1]
 |
Names |
Preferred IUPAC name
4-(2-Hydroxyethyl)-2-methoxyphenol |
Other names
Homovanillic alcohol; MOPET; 3-Methoxy-4-hydroxyphenylethanol; 3-Methoxy-4-hydroxyphenethyl alcohol; 4-Hydroxy-3-methoxyphenethanol, 4-Hydroxy-3-methoxyphenethyl alcohol |
Identifiers |
|
|
|
|
ChEBI |
|
ChEMBL |
|
ChemSpider |
|
ECHA InfoCard |
100.017.433 |
EC Number |
|
|
|
UNII |
|
|
|
InChI=1S/C9H12O3/c1-12-9-6-7(4-5-10)2-3-8(9)11/h2-3,6,10-11H,4-5H2,1H3 N Key: XHUBSJRBOQIZNI-UHFFFAOYSA-N N InChI=1/C9H12O3/c1-12-9-6-7(4-5-10)2-3-8(9)11/h2-3,6,10-11H,4-5H2,1H3 Key: XHUBSJRBOQIZNI-UHFFFAOYAP
|
|
Properties |
|
C9H12O3 |
Molar mass |
168.19 g/mol |
Melting point |
40 to 42 °C (104 to 108 °F; 313 to 315 K) |
Hazards |
GHS labelling:[2] |
|
 |
|
Warning |
|
H315, H319, H335 |
|
P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 |
Flash point |
113 °C (235 °F; 386 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close