Acetozone is an organic peroxide that is a strong oxidant.[1]
Quick facts Names, Identifiers ...
Acetozone
 |
Names |
Preferred IUPAC name
Acetic benzoic peroxyanhydride |
Other names
Acetyl benzoyl peroxide; Benzoyl acetyl peroxide; Benzozone; Acetyl benzenecarboperoxoate |
Identifiers |
|
|
|
|
ChemSpider |
|
ECHA InfoCard |
100.010.376 |
EC Number |
|
|
|
UNII |
|
|
|
InChI=1S/C9H8O4/c1-7(10)12-13-9(11)8-5-3-2-4-6-8/h2-6H,1H3 Key: PDAVOLCVHOKLEO-UHFFFAOYSA-N
|
|
Properties |
|
C9H8O4 |
Molar mass |
180.159 g·mol−1 |
Appearance |
White crystalline solid[1] |
Melting point |
36–37 °C (97–99 °F; 309–310 K)[2] |
Boiling point |
130 °C (266 °F; 403 K)[2] (19 mmHg) |
|
Soluble in carbon tetrachloride, chloroform, ether, and oils[2] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
In the early 20th century, it found use as a surgical antiseptic[3] and for the treatment of typhoid fever.[4]
It has also been used as a bleaching agent for flour.[2][5]