α-Methylhistamine is a synthetic derivative and a selective histamine H3 receptor. It decreases blood pressure and heart rate in guinea pigs.[2] The drug also has sedative and hypnotic effects in animals.[3][4][5][6]
Quick facts Names, Identifiers ...
α-Methylhistamine
Skeletal formula of a minor tautomer of alpha-methylhistamine |
Names |
IUPAC name
1-(3H-Imidazol-4-yl)propan-2-amine |
Systematic IUPAC name
1-(1 H-Imidazol-4-yl)propan-2-amine [1] |
Identifiers |
|
|
|
|
ChEBI |
|
ChEMBL |
|
ChemSpider |
|
|
|
MeSH |
Alpha-methylhistamine |
|
|
|
|
InChI=1S/C6H11N3/c1-5(7)2-6-3-8-4-9-6/h3-5H,2,7H2,1H3,(H,8,9) Y Key: XNQIOISZPFVUFG-UHFFFAOYSA-N Y InChI=1/C6H11N3/c1-5(7)2-6-3-8-4-9-6/h3-5H,2,7H2,1H3,(H,8,9) Key: XNQIOISZPFVUFG-UHFFFAOYAW
|
|
Properties |
|
C6H11N3 |
Molar mass |
125.175 g·mol−1 |
log P |
−0.346 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close