Benz[e]acephenanthrylene is an organic compound with the chemical formula C20H12. It is a polycyclic aromatic hydrocarbon (PAH) made of four benzene rings around a 5-membered ring.
Quick facts Names, Identifiers ...
Benz[e]acephenanthrylene[1][2]
 |
| Names |
Preferred IUPAC name
Benzo[e]acephenanthrylene |
Other names
Benzo[ b]fluoranthene; Benzo[ e]fluoranthene; 2,3-Benzofluoranthrene; B[ b]F; 2,3-Benzofluoranthene; 4,5-Benzofluoranthene; 2,3-Benzfluoranthene; 3,4-Benzfluoranthene; 3,4-Benzofluoranthene; Benz[b ]fluoranthene [1] |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| ECHA InfoCard |
100.005.375 |
| EC Number |
|
| KEGG |
|
|
|
| RTECS number |
|
| UNII |
|
| UN number |
2811, 3077 |
|
|
InChI=FTOVXSOBNPWTSH-UHFFFAOYSA-N [1]: InChI=1S/C20H12/c1-2-7-14-13(6-1)12-19-16-9-4-3-8-15(16)18-11-5-10-17(14)20(18)19/h1-12H
|
[2]: C1=CC=C2C3=C4C(=CC=C3)C5=CC=CC=C5C4=CC2=C1
|
| Properties |
|
C20H12 |
| Molar mass |
252.316 g·mol−1 |
| Appearance |
Off-white to tan powder[2] |
| Density |
1.286 g/cm3 |
| Melting point |
166 °C (331 °F; 439 K)[2] |
| Boiling point |
481 °C (898 °F; 754 K) |
| Hazards |
| GHS labelling: |
|
  |
|
Danger |
|
H350, H410 |
|
P201, P202, P273, P281, P308+P313, P391, P405, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
