Octabenzone (Spectra-Sorb UV 531, MPI Milestab 81) is a UV absorber/screener. It is used to protect polymers (e.g., polyethylene, polypropylene, polyvinylchloride) against damage by UV light.
Quick facts Names, Identifiers ...
Octabenzone
 |
| Names |
Preferred IUPAC name
[2-Hydroxy-4-(octyloxy)phenyl](phenyl)methanone |
| Other names
Benzophenone-12, Spectra-Sorb UV 531, MPI Milestab 81 |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.015.838 |
| KEGG |
|
| MeSH |
(2-hydroxy-4-(octyloxy)phenyl)phenylmethanone |
|
|
| UNII |
|
|
|
InChI=1S/C21H26O3/c1-2-3-4-5-6-10-15-24-18-13-14-19(20(22)16-18)21(23)17-11-8-7-9-12-17/h7-9,11-14,16,22H,2-6,10,15H2,1H3 Y Key: QUAMTGJKVDWJEQ-UHFFFAOYSA-N Y InChI=1/C21H26O3/c1-2-3-4-5-6-10-15-24-18-13-14-19(20(22)16-18)21(23)17-11-8-7-9-12-17/h7-9,11-14,16,22H,2-6,10,15H2,1H3 Key: QUAMTGJKVDWJEQ-UHFFFAOYAM
|
O=C(c1ccc(OCCCCCCCC)cc1O)c2ccccc2
|
| Properties |
|
C21H26O3 |
| Molar mass |
326.429 g/mol |
| Appearance |
Light Yellow to Colourless Solid |
| Melting point |
47–49 °C (117–120 °F; 320–322 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close