Traumatin is a plant hormone produced in response to wound.[1] Traumatin is a precursor to the related hormone traumatic acid.
Quick facts Names, Identifiers ...
Traumatin
 |
| Names |
Preferred IUPAC name
(10E)-12-Oxododec-10-enoic acid |
| Other names
Δ10-ODA |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
|
|
|
|
InChI=1S/C12H20O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h7,9,11H,1-6,8,10H2,(H,14,15)/b9-7+ Y Key: INMKWUNQKOWGEZ-VQHVLOKHSA-N Y InChI=1/C12H20O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h7,9,11H,1-6,8,10H2,(H,14,15)/b9-7+ Key: INMKWUNQKOWGEZ-VQHVLOKHBG
|
|
| Properties |
|
C12H20O3 |
| Molar mass |
212.2854 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close