Rhododendrin (betuloside) is an arylbutanoid glycoside and a phenylpropanoid, a type of natural phenol. It can be found in the leaves of Rhododendron aureum[1] or in Cistus salviifolius.[2]
Quick facts Names, Identifiers ...
Rhododendrin
Chemical structure of Rhododendrin |
| Names |
| IUPAC name
(2R)-4-(4-Hydroxyphenyl)butan-2-yl β-D-glucopyranoside |
Systematic IUPAC name
(2R,3S,4S,5R,6R)-2-(Hydroxymethyl)-6-{{#parsoidfragment:0}}{[(2R)-4-(4-hydroxyphenyl)butan-2-yl]oxy}oxane-3,4,5-triol |
| Other names
Betuloside (-)-Rhododendrin |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C16H24O7/c1-9(2-3-10-4-6-11(18)7-5-10)22-16-15(21)14(20)13(19)12(8-17)23-16/h4-7,9,12-21H,2-3,8H2,1H3/t9-,12-,13-,14+,15-,16-/m1/s1 Key: KLLYDTMVSVIJEH-YYMOATHLSA-N
|
CC(CCC1=CC=C(C=C1)O)OC2C(C(C(C(O2)CO)O)O)O
|
| Properties |
|
C16H24O7 |
| Molar mass |
328.361 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
In vitro, it shows analgesic, anti-inflammatory[1] and diuretic[3] properties.