Rosinidin is an O-methylated anthocyanidin derived from Cyanidin. It is a pigment found in the flowers of Catharanthus roseus[1] and, in lower concentration, in Primula rosea.[2]
Quick facts Names, Identifiers ...
Rosinidin
 |
| Names |
| IUPAC name
3,4′,5-Trihydroxy-3′,7-dimethoxyflavylium |
Systematic IUPAC name
3,5-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-1λ4-benzopyran-1-ylium |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
|
|
|
|
InChI=1S/C17H14O6/c1-21-10-6-13(19)11-8-14(20)17(23-15(11)7-10)9-3-4-12(18)16(5-9)22-2/h3-8H,1-2H3,(H2-,18,19,20)/p+1 N Key: GNONHFYAESLOCB-UHFFFAOYSA-O N InChI=1/C17H14O6/c1-21-10-6-13(19)11-8-14(20)17(23-15(11)7-10)9-3-4-12(18)16(5-9)22-2/h3-8H,1-2H3,(H2-,18,19,20)/p+1 Key: GNONHFYAESLOCB-IKLDFBCSAN
|
Oc1cc2c(O)cc(OC)cc2[o+]c1c3cc(OC)c(O)cc3
|
| Properties |
|
C17H15O6+ |
| Molar mass |
315.30 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close