Karanjachromene is a pyranoflavonol, a type of flavonol. It is a fluorescent pyranoflavonoid isolated from the seed oil of Millettia pinnata.[1]
Quick facts Names, Identifiers ...
Karanjachromene
 Chemical structure of karanjachromene |
| Names |
| IUPAC name
3-Methoxy-6′′,6′′-dimethyl-6′′H-pyrano[2′′,3′′:7,8]flavone |
Systematic IUPAC name
3-Methoxy-8,8-dimethyl-2-phenyl-4H,8H-(benzo[1,2-b:3,4-b′]dipyran)-4-one |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C21H18O4/c1-21(2)12-11-14-16(25-21)10-9-15-17(22)20(23-3)18(24-19(14)15)13-7-5-4-6-8-13/h4-12H,1-3H3 N Key: QCLBGWSAIHOGCA-UHFFFAOYSA-N N InChI=1/C21H18O4/c1-21(2)12-11-14-16(25-21)10-9-15-17(22)20(23-3)18(24-19(14)15)13-7-5-4-6-8-13/h4-12H,1-3H3 Key: QCLBGWSAIHOGCA-UHFFFAOYAI
|
COc1c(=O)c2ccc3OC(C)(C)C=Cc3c2oc1-c4ccccc4
|
| Properties |
|
C21H18O4 |
| Molar mass |
334.36 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
