Mirificin, also known as daidzein 8-C-(6-apiofuranosylglucoside), is an isoflavone that is found in Pueraria mirifica and Pueraria lobata.[1][2] It has estrogenic activity and hence is a phytoestrogen.[1][2]
Quick facts Names, Identifiers ...
Mirificin
 |
| Names |
| IUPAC name
8-[β-D-Apiofuranosyl-(1→6)-β-D-glucopyranosyloxy]-4′,7-dihydroxyisoflavone |
Systematic IUPAC name
8-[(2S,3R,4R,5S,6R)-6-({[(2R,3R,4R)-3,4-Dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy}methyl)-3,4,5-trihydroxyoxan-2-yl]-7-hydroxy-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
| Other names
Daidzein 8-C-(6-apiofuranosylglucoside) |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C26H28O13/c27-9-26(35)10-38-25(24(26)34)37-8-16-19(31)20(32)21(33)23(39-16)17-15(29)6-5-13-18(30)14(7-36-22(13)17)11-1-3-12(28)4-2-11/h1-7,16,19-21,23-25,27-29,31-35H,8-10H2/t16-,19-,20+,21-,23+,24+,25-,26-/m1/s1 Key: ZBXWGKPUSLRPHX-QOIVFALESA-N
|
C1[C@@]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)C3=C(C=CC4=C3OC=C(C4=O)C5=CC=C(C=C5)O)O)O)O)O)O)(CO)O
|
| Properties |
|
C26H28O13 |
| Molar mass |
548.497 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close