Amurensin A is an oligostilbene isolated from the roots of Vitis amurensis.[1] It is a partially oxidized resveratrol dimer with a C8-C8' connection.[2]
Quick facts Names, Identifiers ...
Amurensin A
 Chemical structure of amurensin A |
| Names |
| IUPAC name
5,5'-((3S,4S,Z)-4-hydroxy-1,4-bis(4-hydroxyphenyl)but-1-ene-2,3-diyl)bis(benzene-1,3-diol) |
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
| UNII |
|
InChI=1S/C28H24O7/c29-20-5-1-16(2-6-20)9-26(18-10-22(31)14-23(32)11-18)27(19-12-24(33)15-25(34)13-19)28(35)17-3-7-21(30)8-4-17/h1-15,27-35H/b26-9+/t27-,28+/m0/s1 Key: GCORPFHXPBERCR-WFRBMYQMSA-N
|
OC1=CC(/C([C@@H]([C@H](O)C2=CC=C(O)C=C2)C3=CC(O)=CC(O)=C3)=C\C4=CC=C(O)C=C4)=CC(O)=C1
|
| Properties |
|
C28H24O7 |
| Molar mass |
472.48 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
