Sophoradin is an isoprenyl chalconoid,[1] a type of polyphenolic compound, found in Sophora tonkinensis, an herb used in traditional Chinese medicine.
Quick facts Names, Identifiers ...
 
Sophoradin
 
|  Chemical structure of sophoradin | 
| Names | 
| Preferred IUPAC name 2′,4,4′-Trihydroxy-3,3′,5-tris(3-methylbut-2-en-1-yl)chalcone | 
| Identifiers | 
|  |  | 
|  |  | 
| ChemSpider |  | 
|  |  | 
| UNII |  | 
|  |  | 
| 
InChI=1S/C30H36O4/c1-19(2)7-11-23-17-22(18-24(29(23)33)12-8-20(3)4)10-15-27(31)26-14-16-28(32)25(30(26)34)13-9-21(5)6/h7-10,14-18,32-34H,11-13H2,1-6H3/b15-10+ N Key: YAPAFDNQABLIIN-XNTDXEJSSA-N NInChI=1/C30H36O4/c1-19(2)7-11-23-17-22(18-24(29(23)33)12-8-20(3)4)10-15-27(31)26-14-16-28(32)25(30(26)34)13-9-21(5)6/h7-10,14-18,32-34H,11-13H2,1-6H3/b15-10+ Key: YAPAFDNQABLIIN-XNTDXEJSBZ
 | 
| 
O=C(c1ccc(O)c(c1O)C\C=C(/C)C)\C=C\c2cc(c(O)c(c2)C/C=C(\C)C)C\C=C(/C)C
 | 
| Properties | 
|  | C30H36O4 | 
| Molar mass | 460.614 g·mol−1 | 
| Except where otherwise noted, data are given for materials in their standard state  (at 25 °C [77 °F], 100 kPa). | 
Close
Sofalcone is an oral gastrointestinal medication and a synthetic analog of sophoradin.[2]