Dihydrothymine is an intermediate in the metabolism of thymine.
Quick facts Names, Identifiers ...
Dihydrothymine
 |
| Names |
| IUPAC name
5-methylhexahydropyrimidine-2,4-dione |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.010.717 |
| MeSH |
5,6-dihydrothymine |
|
|
| UNII |
|
|
|
InChI=1S/C5H8N2O2/c1-3-2-6-5(9)7-4(3)8/h3H,2H2,1H3,(H2,6,7,8,9) N Key: NBAKTGXDIBVZOO-UHFFFAOYSA-N N InChI=1/C5H8N2O2/c1-3-2-6-5(9)7-4(3)8/h3H,2H2,1H3,(H2,6,7,8,9) Key: NBAKTGXDIBVZOO-UHFFFAOYAR
|
|
| Properties |
|
C5H8N2O2 |
| Molar mass |
128.12922 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close