δ-Octalactone is a lactone and aroma compound with a creamy cocoa, coconut, and peach flavor.[1][2][3] Its chemical formula is C8H14O2.[4]
Quick facts Names, Identifiers ...
δ-Octalactone
 |
| Names |
| Preferred IUPAC name
|
| Other names
Tetrahydro-6-propyl-2H-pyran-2-one |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.010.747 |
| EC Number |
|
|
|
| UNII |
|
|
|
InChI=1S/C8H14O2/c1-2-4-7-5-3-6-8(9)10-7/h7H,2-6H2,1H3 Key: FYTRVXSHONWYNE-UHFFFAOYSA-N InChI=1S/C8H14O2/c1-2-4-7-5-3-6-8(9)10-7/h7H,2-6H2,1H3 Key: FYTRVXSHONWYNE-UHFFFAOYSA-N
|
|
| Properties |
|
C8H14O2 |
| Molar mass |
142.198 g·mol−1 |
| Appearance |
Colorless to pale yellow liquid |
| Density |
1.002 g/cm3 |
| Boiling point |
238 °C (460 °F; 511 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close