Sodium orthophenyl phenol is a compound used as a disinfectant. It is the sodium salt of 2-phenylphenol.
Quick Facts Names, Identifiers ...
Sodium orthophenyl phenol
 |
 |
Names |
Preferred IUPAC name
Sodium [1,1′-biphenyl]-2-olate |
Other names
- (1,1′-Biphenyl)-2-ol, sodium salt
- 2-Hydroxydiphenyl sodium
- o-Phenylphenol sodium
- o-Phenylphenol, sodium
- Sodium o-phenylphenol
- Sodium 2-phenylphenolate
- Sodium o-phenylphenate
|
Identifiers |
|
|
|
|
ChEMBL |
|
ChemSpider |
|
ECHA InfoCard |
100.004.597 |
E number |
E232 (preservatives) |
|
|
UNII |
|
|
|
InChI=1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1 Y Key: KSQXVLVXUFHGJQ-UHFFFAOYSA-N Y InChI=1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1
|
[O-]C1=C(C2=CC=CC=C2)C=CC=C1.[Na+]
|
Properties |
|
C12H9NaO |
Molar mass |
192.193 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
As a food additive, it has E number E232.[1]