Gnetucleistol E is a stilbenoid found in the Chinese herb Gnetum cleistostachyum.[1]
Quick facts Names, Identifiers ...
Gnetucleistol E
Chemical structure of gnetucleistol E |
| Names |
| IUPAC name
5-[2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol |
| Other names
3-methoxy-isorhapontigenin |
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
InChI=1S/C16H16O4/c1-19-15-6-5-11(9-16(15)20-2)3-4-12-7-13(17)10-14(18)8-12/h3-10,17-18H,1-2H3/b4-3+ Key: WHKSEHKYYXHCTA-ONEGZZNKSA-N InChI=1/C16H16O4/c1-19-15-6-5-11(9-16(15)20-2)3-4-12-7-13(17)10-14(18)8-12/h3-10,17-18H,1-2H3/b4-3+ Key: WHKSEHKYYXHCTA-ONEGZZNKBB
|
COC1=C(C=C(C=C1)C=CC2=CC(=CC(=C2)O)O)OC
|
| Properties |
|
C16H16O4 |
| Molar mass |
272.300 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close