Kadethrin is a synthetic pyrethroid with the chemical formula C23H24O4S which is used as an insecticide. It is the most potent knockdown pyrethroid (even stronger than pyrethrin II) but it is relatively unstable, especially when exposed to light (due to both the furan ring and the thiolactone group in the molecule).[2]
Quick Facts Names, Identifiers ...
Kadethrin[1]
 |
Names |
Preferred IUPAC name
(5-Benzylfuran-3-yl)methyl (1R,3S)-2,2-dimethyl-3-[(E)-(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate |
Identifiers |
|
|
|
|
|
1605066 |
ChEBI |
|
ChemSpider |
|
ECHA InfoCard |
100.055.830 |
EC Number |
|
|
|
RTECS number |
|
UNII |
|
|
|
InChI=1S/C23H24O4S/c1-23(2)19(12-17-8-9-28-22(17)25)20(23)21(24)27-14-16-11-18(26-13-16)10-15-6-4-3-5-7-15/h3-7,11-13,19-20H,8-10,14H2,1-2H3/b17-12+/t19-,20-/m0/s1 Y Key: UGWALRUNBSBTGI-ZKMZRDRYSA-N Y InChI=1/C23H24O4S/c1-23(2)19(12-17-8-9-28-22(17)25)20(23)21(24)27-14-16-11-18(26-13-16)10-15-6-4-3-5-7-15/h3-7,11-13,19-20H,8-10,14H2,1-2H3/b17-12+/t19-,20-/m0/s1 Key: UGWALRUNBSBTGI-ZKMZRDRYBN
|
O=C(OCc2cc(Cc1ccccc1)oc2)[C@@H]4[C@H](\C=C3/CCSC3=O)C4(C)C
|
Properties |
|
C23H24O4S |
Molar mass |
396.50 g·mol−1 |
Hazards |
GHS labelling: |
|
  |
|
Warning |
|
H302, H312, H332, H410 |
|
P261, P264, P270, P271, P273, P280, P301+P312, P302+P352, P304+P312, P304+P340, P312, P322, P330, P363, P391, P501 |
Flash point |
100 °C (212 °F; 373 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close