Monopotassium glutamate (MPG) is the compound with formula KC5H8NO4. It is a potassium salt of glutamic acid.
Quick facts Names, Identifiers ...
Monopotassium glutamate
 |
 |
Names |
IUPAC name
Potassium 2-amino-5-hydroxy-5-oxopentanoate |
Other names
- Potassium glutamate
- E622
- Glutamic acid potassium salt
|
Identifiers |
|
|
|
|
ChemSpider |
|
ECHA InfoCard |
100.039.161 |
E number |
E622 (flavour enhancer) |
|
|
UNII |
|
|
|
InChI=1S/C5H9NO4.K/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);/q;+1/p-1 Y Key: HQEROMHPIOLGCB-UHFFFAOYSA-M Y InChI=1/C5H9NO4.K/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);/q;+1/p-1 Key: HQEROMHPIOLGCB-REWHXWOFAL
|
[K+].O=C([O-])C(N)CCC(=O)O
|
Properties |
|
C5H8KNO4 |
Molar mass |
185.220 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
It has the E number E622 and is used in foods as a flavor enhancer. It is a non-sodium MSG alternative.