Nitrosoproline is a nitroso derivative of the amino acid proline.
Quick facts Names, Identifiers ...
Nitrosoproline
 |
| Names |
| IUPAC name
1-Nitroso-L-proline |
| Other names
N-Nitrosoproline; Proline nitric oxide; Proline NO |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| KEGG |
|
|
|
| UNII |
|
|
|
InChI=1S/C5H8N2O3/c8-5(9)4-2-1-3-7(4)6-10/h4H,1-3H2,(H,8,9)/t4-/m0/s1 Key: WLKPHJWEIIAIFW-BYPYZUCNSA-N InChI=1/C5H8N2O3/c8-5(9)4-2-1-3-7(4)6-10/h4H,1-3H2,(H,8,9)/t4-/m0/s1 Key: WLKPHJWEIIAIFW-BYPYZUCNBF
|
|
| Properties |
|
C5H8N2O3 |
| Molar mass |
144.130 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close