Sulfometuron methyl is an organic compound used as an herbicide.[1] It is classed as a sulfonylurea. It functions via the inhibition of the enzyme acetolactate synthase, which catalyzes the first step in biosynthesis of the branched-chain amino acids valine, leucine, and isoleucine.[2]
Quick facts Names, Identifiers ...
Sulfometuron methyl
 |
Names |
Preferred IUPAC name
Methyl 2-{[(4,6-dimethylpyrimidin-2-yl)carbamoyl]sulfamoyl}benzoate |
Identifiers |
|
|
|
|
ChEBI |
|
ChEMBL |
|
ChemSpider |
|
ECHA InfoCard |
100.070.688 |
EC Number |
|
KEGG |
|
|
|
UNII |
|
|
|
InChI=1S/C15H16N4O5S/c1-9-8-10(2)17-14(16-9)18-15(21)19-25(22,23)12-7-5-4-6-11(12)13(20)24-3/h4-8H,1-3H3,(H2,16,17,18,19,21) Key: ZDXMLEQEMNLCQG-UHFFFAOYSA-N
|
CC1=CC(=NC(=N1)NC(=O)NS(=O)(=O)C2=CC=CC=C2C(=O)OC)C
|
Properties |
|
C15H16N4O5S |
Molar mass |
364.38 g·mol−1 |
Appearance |
White solid |
Density |
1.48 g/cm3 |
Melting point |
202 °C (396 °F; 475 K) |
|
244 mg/L |
Acidity (pKa) |
5.2 |
Hazards |
GHS labelling: |
|
  |
|
Warning |
|
H319, H332, H410 |
|
P261, P264+P265, P271, P273, P280, P304+P340, P305+P351+P338, P317, P337+P317, P391, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
Sulfometuron methyl's HRAC classification is Group B (global, Aus), Group 2 (numeric), as it inhibits acetohydroxyacid synthase.[3]