TAPSO is used to make buffer solutions. It has a pKa value of 7.635 (I=0, 25°C).[1] It can be used to make buffer solutions in the pH range 7.0-8.2.
Quick facts Names, Identifiers ...
TAPSO
 |
| Names |
| IUPAC name
3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-hydroxypropane-1-sulfonic acid |
| Other names
3-[N-Tris(hydroxymethyl)methylamino]-2-hydroxypropanesulfonic acid |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.063.611 |
|
|
| UNII |
|
|
|
InChI=1S/C7H17NO7S/c9-3-7(4-10,5-11)8-1-6(12)2-16(13,14)15/h6,8-12H,1-5H2,(H,13,14,15) N Key: RZQXOGQSPBYUKH-UHFFFAOYSA-N N InChI=1/C7H17NO7S/c9-3-7(4-10,5-11)8-1-6(12)2-16(13,14)15/h6,8-12H,1-5H2,(H,13,14,15) Key: RZQXOGQSPBYUKH-UHFFFAOYAF
|
O=S(=O)(O)CC(O)CNC(CO)(CO)CO
|
| Properties |
|
C7H17NO7S |
| Molar mass |
259.28 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close