Metepa is a chemosterilant, with the capability to restrict ovarian development.[2] Metepa can also result in carcinogenesis, in particular the formation of teratomas.[3] It a minor ingredient in certain solid rocket propellants.[4]
Quick Facts Names, Identifiers ...
Metepa
 |
Names |
IUPAC name
1-[Bis(2-methyl-1-aziridinyl)phosphoryl]-2-methylaziridine |
Preferred IUPAC name
1,1′,1″-Phosphoryltris(2-methylaziridine) |
Other names
Methaphoxide Metapoxide Methyl aphoxide METEPA Trimethylaziridinylphosphine oxide MAPO Tris(1,2-propylene)phosphoramide Tris(2-methyl-1-aziridinyl)phosphine oxide |
Identifiers |
|
|
|
|
ChemSpider |
|
ECHA InfoCard |
100.000.296 |
KEGG |
|
|
|
UNII |
|
|
|
InChI=1S/C9H18N3OP/c1-7-4-10(7)14(13,11-5-8(11)2)12-6-9(12)3/h7-9H,4-6H2,1-3H3 Y Key: AVUYXHYHTTVPRX-UHFFFAOYSA-N Y InChI=1/C9H18N3OP/c1-7-4-10(7)14(13,11-5-8(11)2)12-6-9(12)3/h7-9H,4-6H2,1-3H3 Key: AVUYXHYHTTVPRX-UHFFFAOYAF
|
CC1CN1P(=O)(N2CC2C)N3CC3C
|
Properties[1] |
|
C9H18N3OP |
Molar mass |
215.237 g·mol−1 |
Appearance |
Colorless liquid |
Boiling point |
90 to 92 °C (194 to 198 °F; 363 to 365 K) (0.15-0.3 mmHg) |
Hazards |
Lethal dose or concentration (LD, LC): |
|
136 mg/kg (male rat, oral)[1] 213 mg/kg (female rat, oral)[1] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close