بی فنیل (همچنین شناخته شده به عنوان دی فنیل، فنیل بنزین، ۱–۱-بی فنیل، لیمونن یا BP) یک ترکیب آلی است که به شکل کریستالهای بیرنگ است.[۴]
اطلاعات اجمالی نامها, شناسه ...
بیفنیل
 |
 |
 |
نامها |
Preferred IUPAC name
|
Other names
Biphenyl Phenyl benzene |
شناسه |
|
|
|
|
ChEBI |
|
ChEMBL |
|
ChemSpider |
|
ECHA InfoCard |
۱۰۰٫۰۰۱٫۹۶۷ |
E number |
E230 (preservatives) |
KEGG |
|
|
|
UNII |
|
InChI=1S/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H Y Key: ZUOUZKKEUPVFJK-UHFFFAOYSA-N Y
InChI=1/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H Key: ZUOUZKKEUPVFJK-UHFFFAOYAV
|
|
مشخصات |
|
C12H10 |
Molar mass |
154.21 g·mol−1 |
Appearance |
Colorless to pale-yellow crystals |
Odor |
pleasant |
Density |
1.04 g/cm3[۱] |
Melting point |
۶۹٫۲ °C (156.6 °F; 342.3 K) |
Boiling point |
۲۵۵ °C (491 °F; 528 K) |
|
4.45 mg/L |
Vapor pressure |
0.005 mmHg (۲۰°C) |
|
−۱۰۳٫۲۵·10−6 cm3/mol |
خطرات |
EU classification (DSD) (outdated) |
Irritant (Xi) Dangerous for the environment (N) |
R-phrases (outdated) |
R36/37/38 R50/53 |
S-phrases (outdated) |
(S2) S23 S60 S61 |
NFPA 704 |
|
Flash point |
۱۱۳ °C (235 °F; 386 K) |
|
۵۴۰ °C (1,004 °F; 813 K) |
Explosive limits |
۰٫۶–۵٫۸٪ |
Lethal dose or concentration (LD, LC): |
|
2400 mg/kg (oral, rabbit) 3280 mg/kg (oral, rat) 1900 mg/kg (oral, mouse) 2400 mg/kg (oral, rat)[۲] |
US health exposure limits (NIOSH): |
PEL (Permissible) |
TWA 1 mg/m3 (0.2 ppm)[۳] |
REL (Recommended) |
TWA 1 mg/m3 (0.2 ppm) |
IDLH (Immediate danger) |
100 mg/m3 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
N verify (what is YN ?) |
Infobox references |
بستن