(2-Chlorophenyl)thiourea is a chemical compound used as an herbicide. As of 1998, the Environmental Protection Agency did not have it registered as a pesticide in the United States.[2]
Quick Facts Names, Identifiers ...
(2-Chlorophenyl)thiourea
 |
Names |
Preferred IUPAC name
N-(2-Chlorophenyl)thiourea |
Other names
1-(2-Chlorophenyl)thiourea (o-Chlorophenyl)thiourea |
Identifiers |
|
|
|
|
ChemSpider |
|
ECHA InfoCard |
100.023.901 |
|
|
UNII |
|
|
|
InChI=1S/C7H7ClN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) Key: YZUKKTCDYSIWKJ-UHFFFAOYSA-N InChI=1/C7H7ClN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) Key: YZUKKTCDYSIWKJ-UHFFFAOYAH
|
|
Properties |
|
C7H7ClN2S |
Molar mass |
186.66 g·mol−1 |
Melting point |
146 °C (295 °F; 419 K)[1] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close