2-Methoxyestriol (2-MeO-E3) is an endogenous estrogen metabolite.[1][2][3] It is specifically a metabolite of estriol and 2-hydroxyestriol.[1][2][3] It has negligible affinity for the estrogen receptors and no estrogenic activity.[4] However, 2-methoxyestriol does have some non-estrogen receptor-mediated cholesterol-lowering effects.[5]
More information Estrogen, ERTooltip Estrogen receptor RBATooltip relative binding affinity (%) ...
Close
Quick facts Names, Identifiers ...
2-Methoxyestriol
 |
| Names |
| IUPAC name
2-Methoxyestra-1,3,5(10)-triene-3,16α,17β-triol |
Systematic IUPAC name
(1R,2R,3aS,3bR,9bS,11aS)-8-Methoxy-11a-methyl-2,3,3a,3b,4,5,9b,10,11,11a-decahydro-1H-cyclopenta[a]phenanthrene-1,2,7-triol |
| Other names
2-MeO-E3 |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
|
|
|
|
InChI=1S/C19H26O4/c1-19-6-5-11-12(14(19)9-16(21)18(19)22)4-3-10-7-15(20)17(23-2)8-13(10)11/h7-8,11-12,14,16,18,20-22H,3-6,9H2,1-2H3/t11-,12+,14-,16+,18-,19-/m0/s1 Key: PEXPJFWTSZLEAQ-YSYMNNNUSA-N
|
C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@@H]2O)O)CCC4=CC(=C(C=C34)OC)O
|
| Properties |
|
C19H26O4 |
| Molar mass |
318.413 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close