3-Methyl-2-pentanol (IUPAC name: 3-methylpentan-2-ol) is an organic chemical compound. It has been identified as a component of hops.[2] Its presence in urine can be used to test for exposure to 3-methylpentane.[3]
Quick facts Names, Identifiers ...
3-Methyl-2-pentanol[1]
 |
Names |
Preferred IUPAC name
|
Other names
3-Methyl-2-pentanol |
Identifiers |
|
|
|
|
ChEBI |
|
ChemSpider |
|
ECHA InfoCard |
100.008.438 |
EC Number |
|
|
|
|
|
InChI=1S/C6H14O/c1-4-5(2)6(3)7/h5-7H,4H2,1-3H3 Y Key: ZXNBBWHRUSXUFZ-UHFFFAOYSA-N Y InChI=1/C6H14O/c1-4-5(2)6(3)7/h5-7H,4H2,1-3H3 Key: ZXNBBWHRUSXUFZ-UHFFFAOYAP
|
|
Properties |
|
C6H14O |
Molar mass |
102.174 g/mol |
Appearance |
colorless liquid |
Density |
0.8307 g/cm3 at 20 °C |
Boiling point |
134.3 °C (273.7 °F; 407.4 K) |
|
19 g/L |
Solubility |
soluble in ethanol, diethyl ether |
Thermochemistry |
|
275.9 J·mol−1·K−1 (liquid) |
Hazards |
GHS labelling: |
|
  |
|
Warning |
|
H226, H319 |
|
P210, P233, P240, P241, P242, P243, P264, P280, P303+P361+P353, P305+P351+P338, P337+P313, P370+P378, P403+P235, P501 |
Related compounds |
Related compounds |
Hexanol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close