3-Ureidopropionic acid, also called N-carbamoyl-beta-alanine, is an intermediate in the metabolism of uracil. It is a urea derivative of beta-alanine.
Quick Facts Names, Identifiers ...
3-Ureidopropionic acid
Skeletal formula of 3-ureidopropionic acid |
Names |
Preferred IUPAC name
3-(Carbamoylamino)propanoic acid |
Other names
3-Ureidopropanoic acid |
Identifiers |
|
|
|
|
|
1705263 |
ChEBI |
|
ChEMBL |
|
ChemSpider |
|
ECHA InfoCard |
100.255.338 |
EC Number |
|
|
675230 |
KEGG |
|
MeSH |
N-carbamoyl-beta-alanine |
|
|
UNII |
|
|
|
InChI=1S/C4H8N2O3/c5-4(9)6-2-1-3(7)8/h1-2H2,(H,7,8)(H3,5,6,9) N Key: JSJWCHRYRHKBBW-UHFFFAOYSA-N N
|
|
Properties |
|
C4H8N2O3 |
Molar mass |
132.119 g·mol−1 |
Appearance |
White crystals |
log P |
−1.23 |
Acidity (pKa) |
4.408 |
Basicity (pKb) |
9.589 |
Hazards |
GHS labelling:[1] |
|
 |
|
Warning |
|
H302, H315, H319, H335 |
|
P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, P501 |
Related compounds |
Related alkanoic acids |
|
Related compounds |
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close