4-Chlorobenzonitrile is an organic compound with the formula ClC6H4CN. It is a white solid. The compound, one of three isomers of chlorobenzonitrile, is produced industrially by ammoxidation of 4-chlorotoluene. The compound is of commercial interest as a precursor to pigments.[2]
Quick facts Names, Identifiers ...
4-Chlorobenzonitrile
 |
Names |
IUPAC name
4-Chlorobenzonitrile |
Other names
p-Chlorobenzonitrile |
Identifiers |
|
|
|
|
ChEMBL |
|
ChemSpider |
|
ECHA InfoCard |
100.009.788 |
EC Number |
|
|
|
UNII |
|
|
|
InChI=1S/C7H4ClN/c8-7-3-1-6(5-9)2-4-7/h1-4H Key: GJNGXPDXRVXSEH-UHFFFAOYSA-N
|
|
Properties |
|
C7H4ClN |
Molar mass |
137.57 g·mol−1 |
Appearance |
white solid |
Melting point |
97 °C (207 °F; 370 K) |
Hazards |
GHS labelling:[1] |
|
  |
|
Danger |
|
H302, H311, H319, H332, H412 |
|
P261, P264, P270, P271, P273, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P361, P362, P363, P403+P233, P405, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close