7-O-Methylluteone is a prenylated isoflavone. It can be found in the bark of Erythrina burttii.[1]
Quick facts Names, Identifiers ...
7-O-Methylluteone
 |
| Names |
| IUPAC name
2′,4′,5-Trihydroxy-7-methoxy-6-(3-methylbut-2-en-1-yl)isoflavone |
Systematic IUPAC name
3-(2,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-6-(3-methylbut-2-en-1-yl)-4H-1-benzopyran-4-one |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
| KEGG |
|
|
|
| UNII |
|
|
|
InChI=1S/C21H20O6/c1-11(2)4-6-14-17(26-3)9-18-19(20(14)24)21(25)15(10-27-18)13-7-5-12(22)8-16(13)23/h4-5,7-10,22-24H,6H2,1-3H3 Key: AZPLXDBZIQMMMT-UHFFFAOYSA-N InChI=1/C21H20O6/c1-11(2)4-6-14-17(26-3)9-18-19(20(14)24)21(25)15(10-27-18)13-7-5-12(22)8-16(13)23/h4-5,7-10,22-24H,6H2,1-3H3 Key: AZPLXDBZIQMMMT-UHFFFAOYAB
|
CC(=CCC1=C(C=C2C(=C1O)C(=O)C(=CO2)C3=C(C=C(C=C3)O)O)OC)C
|
| Properties |
|
C21H20O6 |
| Molar mass |
368.385 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
The enzyme monoprenyl isoflavone epoxidase uses 7-O-methylluteone, NADPH, H+ and O2 to produce a dihydrofurano pyranoisoflavone derivative, NADP+ and H2O.