Acedoben (4-acetamidobenzoic acid or N-acetyl-PABA) is a chemical compound with the molecular formula of C9H9NO3. It is the acetyl derivative of para-aminobenzoic acid (PABA).
Quick Facts Names, Identifiers ...
Acedoben[1][2]
 Skeletal formula |
 Ball-and-stick model |
| Names |
| Preferred IUPAC name
|
| Other names
N-Acetyl-PABA; 4-Carboxyacetanilide; p-Acetamidobenzoic acid
p-Acetaminobenzoic acid; PAAB; p-Acetoaminobenzoic acid |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
| DrugBank |
|
| ECHA InfoCard |
100.008.287 |
|
|
| UNII |
|
|
|
InChI=1S/C9H9NO3/c1-6(11)10-8-4-2-7(3-5-8)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13) Y Key: QCXJEYYXVJIFCE-UHFFFAOYSA-N Y InChI=1/C9H9NO3/c1-6(11)10-8-4-2-7(3-5-8)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13) Key: QCXJEYYXVJIFCE-UHFFFAOYAT InChI=1S/C9H9NO3/c1-6(11)10-8-4-2-7(3-5-8)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13) Key: QCXJEYYXVJIFCE-UHFFFAOYSA-N
|
O=C(Nc1ccc(cc1)C(=O)O)C O=C(Nc1ccc(cc1)C(=O)O)C CC(=O)NC1=CC=C(C=C1)C(=O)O
|
| Properties |
|
C9H9NO3 |
| Molar mass |
179.175 g·mol−1 |
| Melting point |
259 to 262 °C (498 to 504 °F; 532 to 535 K) (dec.) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
Acedoben, as a salt with dimepranol, is a component of some pharmaceutical preparations such as inosine pranobex.
