Allocryptopine is a bioactive alkaloid found in plants of the Papaveraceae family, including Glaucium arabicum,[2] Argemone mexicana, Eschscholtzia, Corydalis, Fumaria, Chelidonium, Hunnemannia fumariifolia, Eschscholzia lobbii[3] and other Papaveraceae plants.[4][5]
Quick facts Names, Identifiers ...
Allocryptopine
 |
| Names |
Preferred IUPAC name
3,4-Dimethoxy-6-methyl-5,7,8,15-tetrahydro-11H-[1,3]benzodioxolo[5,6-e][2]benzazecin-14(6H)-one |
| Other names
Thalictrimine; allo-Cryptopine; α-Fagarine; Fagarine I; α-Allocryptopine; β-Homochelidonine |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
| ECHA InfoCard |
100.006.933 |
| EC Number |
|
| KEGG |
|
|
|
| UNII |
|
|
|
InChI=1S/C21H23NO5/c1-22-7-6-14-9-19-20(27-12-26-19)10-15(14)17(23)8-13-4-5-18(24-2)21(25-3)16(13)11-22/h4-5,9-10H,6-8,11-12H2,1-3H3 Key: HYBRYAPKQCZIAE-UHFFFAOYSA-N
|
CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C(=C(C=C4)OC)OC)OCO3
|
| Properties |
|
C21H23NO5 |
| Molar mass |
369.417 g·mol−1 |
| Hazards |
| Occupational safety and health (OHS/OSH): |
Main hazards |
H302 (100%): Harmful if swallowed, acute toxicity[1] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close