Amthamine is a histamine agonist selective for the H2 subtype.[1] It has been used in vitro and in vivo to study gastric secretion,[2] as well as other functions of the H2 receptor.[3][4][5]
Quick facts Names, Identifiers ...
Amthamine
 |
| Names |
| IUPAC name
5-(2-Aminoethyl)-4-methyl-1,3-thiazol-2-amine |
| Other names
5-(2-Aminoethyl)-4-methyl-2-thiazolamine
2-Amino-5-(2-aminoethyl)-4-methylthiazole |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
|
|
|
|
| UNII |
|
|
|
InChI=1S/C6H11N3S/c1-4-5(2-3-7)10-6(8)9-4/h2-3,7H2,1H3,(H2,8,9) Y Key: LHVRFUVVRXGZPV-UHFFFAOYSA-N Y InChI=1/C6H11N3S/c1-4-5(2-3-7)10-6(8)9-4/h2-3,7H2,1H3,(H2,8,9) Key: LHVRFUVVRXGZPV-UHFFFAOYAV
|
CC1=C(SC(=N1)N)CCN n1c(c(sc1N)CCN)C
|
| Properties |
|
C6H11N3S |
| Molar mass |
157.236 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
