Amurensine is an alkaloid found in Papaver species such as P. alpinum, P. pyrenaicum, P. suaveolens, and P. tatricum[1] and P. nudicaule.[2] It is a member of the isoquinoline group.[3]
Quick facts Names, Identifiers ...
Amurensine
 |
 |
| Names |
| IUPAC name
(1S,11R)-15-Methoxy-19-methyl-5,7-dioxa-19-azapentacyclo[9.7.2.02,10.04,8.012,17]icosa-2,4(8),9,12,14,16-hexaen-14-ol |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
| KEGG |
|
|
|
|
|
InChI=1S/C19H19NO4/c1-20-8-14-11-5-16(21)17(22-2)4-10(11)3-15(20)13-7-19-18(6-12(13)14)23-9-24-19/h4-7,14-15,21H,3,8-9H2,1-2H3/t14-,15+/m1/s1 Key: BXWVSGUITWLTOD-CABCVRRESA-N
|
CN1C[C@@H]2C3=CC(=C(C=C3C[C@H]1C4=CC5=C(C=C24)OCO5)OC)O
|
| Properties |
|
C19H19NO4 |
| Molar mass |
325.364 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
