Auranthine is an antimicrobial chemical compound isolated from a nephrotoxic strain[1] of Penicillium fungus, Penicillium aurantiogriseum.[2]
Quick facts Names, Identifiers ...
Auranthine
 |
| Names |
| IUPAC name
6,7,7a,8-Tetrahydroquinazolino[3’,2’:1,6]pyrido[2,3-b] [1,4]benzodiazepine-9,16-dione |
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
|
|
InChI=1S/C19H14N4O2/c24-18-11-5-1-3-7-13(11)21-17-15(22-18)9-10-16-20-14-8-4-2-6-12(14)19(25)23(16)17/h1-8,15H,9-10H2,(H,22,24) Key: QSYOIPMDADNFRO-UHFFFAOYSA-N InChI=1/C19H14N4O2/c24-18-11-5-1-3-7-13(11)21-17-15(22-18)9-10-16-20-14-8-4-2-6-12(14)19(25)23(16)17/h1-8,15H,9-10H2,(H,22,24) Key: QSYOIPMDADNFRO-UHFFFAOYAR
|
C1CC2=NC3=CC=CC=C3C(=O)N2C4=NC5=CC=CC=C5C(=O)NC41
|
| Properties |
|
C19H14N4O2 |
| Molar mass |
330.347 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
A total synthesis of auranthine has been reported.[3]