Auraptene is a natural bioactive monoterpene coumarin ether. It was first isolated from members of the genus Citrus.
Quick Facts Names, Identifiers ...
Auraptene
 |
| Names |
Preferred IUPAC name
7-{[(2E)-3,7-Dimethylocta-2,6-dien-1-yl]oxy}-2H-1-benzopyran-2-one |
| Other names
Aurapten
7-Geranyloxycoumarin |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C19H22O3/c1-14(2)5-4-6-15(3)11-12-21-17-9-7-16-8-10-19(20)22-18(16)13-17/h5,7-11,13H,4,6,12H2,1-3H3/b15-11+ Y Key: RSDDHGSKLOSQFK-RVDMUPIBSA-N Y InChI=1/C19H22O3/c1-14(2)5-4-6-15(3)11-12-21-17-9-7-16-8-10-19(20)22-18(16)13-17/h5,7-11,13H,4,6,12H2,1-3H3/b15-11+ Key: RSDDHGSKLOSQFK-RVDMUPIBBL
|
O=C/2Oc1cc(OC\C=C(/C)CC\C=C(/C)C)ccc1\C=C\2
|
| Properties |
|
C19H22O3 |
| Molar mass |
298.376 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
Auraptene has shown some effect as a chemopreventative agent against cancers of liver, skin, tongue, esophagus, and colon in rodent models.[1]
