Barium iodate

Barium iodate is an inorganic chemical compound with the chemical formula Ba(IO₃)₂. It is a white, granular substance.

Barium iodate

Unit cell
Identifiers
CAS Number	10567-69-8 Y
3D model (JSmol)	Interactive image
ChemSpider	145385
ECHA InfoCard	100.031.035
PubChem CID	165892
UNII	ST2993NJ5J Y
CompTox Dashboard (EPA)	DTXSID70909677
InChI InChI=1S/Ba.2HIO3/c;2*2-1(3)4/h;2*(H,2,3,4)/q+2;;/p-2 Key: GASILTKHXWGKMG-UHFFFAOYSA-L InChI=1/Ba.2HIO3/c;2*2-1(3)4/h;2*(H,2,3,4)/q+2;;/p-2 Key: GASILTKHXWGKMG-NUQVWONBAR
SMILES [Ba+2].[O-]I(=O)=O.[O-]I(=O)=O
Properties
Chemical formula	Ba(IO3)2
Molar mass	487.13 g/mol
Melting point	580 °C (1,076 °F; 853 K)(decomposes)
Solubility product (Ksp)	1.57 × 10−9[1]
Magnetic susceptibility (χ)	−122.5·10−6 cm3/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Derivation

Barium iodate can be derived either as a product of a reaction of iodine and barium hydroxide or by combining barium chlorate with potassium iodate.^[2]

Chemical properties

The compound is stable on a temperature up to approximately 580 °C (1,076 °F). If the temperature is higher than that value, the following reaction, known as Rammelsberg's reaction, occurs:^[3]

5 Ba(IO₃)₂ → Ba₅(IO₆)₂ + 9 O₂ + 4 I₂