Benz[a]anthracene or benzo[a]anthracene is a polycyclic aromatic hydrocarbon with the chemical formula C18H12.[2] It is produced during incomplete combustion of organic matter.
Quick facts Names, Identifiers ...
Benz[a]anthracene
 |
 |
| Names |
| Preferred IUPAC name
|
Other names
Benz[ a]anthracene Benzanthracene Benzanthrene 1,2-Benzanthracene Benzo[ b]phenanthrene Tetracyclo[8.8.0.0 2,7.0 12,17]octadeca-1,3,5,7,9,11,13,15,17-nonaene [citation needed] |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
| ECHA InfoCard |
100.000.255 |
| KEGG |
|
|
|
| UNII |
|
|
|
InChI=1S/C18H12/c1-2-7-15-12-18-16(11-14(15)6-1)10-9-13-5-3-4-8-17(13)18/h1-12H Y Key: DXBHBZVCASKNBY-UHFFFAOYSA-N Y InChI=1/C18H12/c1-2-7-15-12-18-16(11-14(15)6-1)10-9-13-5-3-4-8-17(13)18/h1-12H Key: DXBHBZVCASKNBY-UHFFFAOYAM
|
c1ccc2c(c1)ccc3c2cc4ccccc4c3
|
| Properties |
|
C18H12 |
| Molar mass |
228.294 g·mol−1 |
| Appearance |
White solid |
| Density |
1.19 g/cm3 |
| Melting point |
158 °C (316 °F; 431 K) |
| Boiling point |
438 °C (820 °F; 711 K) |
| Hazards |
| Flash point |
209.1 °C (408.4 °F; 482.2 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
Benz[a]anthracene is one of carcinogenic constituents of tobacco smoke.[3]