Benzyltrimethylammonium fluoride is a quaternary ammonium salt. It is commercially available as the hydrate. The compound is a source of organic-soluble fluoride to removal of silyl ether protecting groups. As is the case for tetra-n-butylammonium fluoride and most other quaternary ammonium fluorides, the compound cannot be obtained in anhydrous form.
Quick facts Names, Identifiers ...
Benzyltrimethylammonium fluoride[1]
 |
 |
Names |
Preferred IUPAC name
N,N,N-Trimethyl(phenyl)methanaminium fluoride |
Other names
N,N,N-Trimethyl-1-phenylmethanaminium fluoride Benzyltrimethylammonium fluoride |
Identifiers |
|
|
|
|
Abbreviations |
BTAF |
ChemSpider |
|
ECHA InfoCard |
100.149.876 |
EC Number |
|
|
|
UNII |
|
InChI=1S/C10H16N.FH/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H/q+1;/p-1 Y Key: KFSZGBHNIHLIAA-UHFFFAOYSA-M Y InChI=1/C10H16N.FH/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H/q+1;/p-1 Key: KFSZGBHNIHLIAA-REWHXWOFAM
|
C[N+](C)(C)CC1=CC=CC=C1.O.[F-]
|
Properties |
|
C10H18FNO |
Molar mass |
187.258 g·mol−1 |
Appearance |
Solid |
Melting point |
181 to 183 °C (358 to 361 °F; 454 to 456 K) for hydrate |
Hazards |
GHS labelling: |
|
 |
|
Warning |
|
H315, H319, H335 |
|
P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close