Bitartrate is an anion which is the conjugate base of tartaric acid. It may also refer to any salt or monoester of tartaric acid.
Quick Facts Names, Identifiers ...
Bitartrate anion
 |
Names |
Preferred IUPAC name
3-Carboxy-2,3-dihydroxypropanoate [1][2] |
Other names
- Bitartrate
- Butanedioic acid, 2,3-dihydroxy-, ion(1−)
- 3-Carboxylato-2,3-dihydroxypropionic acid
- Hydrogen tartrate
- 2,3,4-Trihydroxy-4-oxobutanoate
- 2,3,4-Trihydroxy-4-oxobutyric acidanion[2][3]
|
Identifiers |
|
|
|
3905887[1][3] |
ChEBI |
|
ChemSpider |
|
|
|
InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/p-1 Key: FEWJPZIEWOKRBE-UHFFFAOYSA-M
|
[1]: OC(C(O)C([O-])=O)C(O)=O [2][3]: C(C(C(=O)[O-])O)(C(=O)O)O
|
Properties |
|
C4H5O6− |
Molar mass |
149.079 g·mol−1 |
Conjugate acid |
Tartaric acid |
Conjugate base |
Tartrate |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
Some examples of bitartrate salts include: