Caesium selenate

Caesium selanate is an inorganic compound, with the chemical formula of Cs₂SeO₄. It can form colourless crystals of the orthorhombic crystal system.

caesium selenate

Identifiers
CAS Number	10326-29-1 Y
3D model (JSmol)	Interactive image
ChemSpider	145356
ECHA InfoCard	100.030.635
EC Number	233-712-7
PubChem CID	165862
CompTox Dashboard (EPA)	DTXSID90889588
InChI InChI=1S/2Cs.H2O4Se/c;;1-5(2,3)4/h;;(H2,1,2,3,4)/q2*+1;/p-2 Key: GIIBVORKUMBCJK-UHFFFAOYSA-L
SMILES [O-][Se](=O)(=O)[O-].[Cs+].[Cs+]
Properties
Chemical formula	Cs2SeO4
Molar mass	408.77
Appearance	colourless crystals[1]
Solubility in water	insoluble
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Preparation

caesium selenate can be obtained from the reaction of caesium carbonate and selenic acid solution:^[2]

Cs₂CO₃ + H₂SeO₄ → Cs₂SeO₄ + H₂O + CO₂↑

caesium selenate can also be prepared by the neutralization reaction of selenic acid and caesium hydroxide:^[1]

2 CsOH + H₂SeO₄ → Cs₂SeO₄ + 2 H₂O

Properties

caesium selenate can precipitate compounds such as CsLiSeO₄·1⁄2H₂O and Cs₄LiH₃(SeO₄)₄ in Cs₂SeO₄-Li₂SeO₄-H₂O and its acidification system.^[2] It can also form double salts with other metals, such as Cs₂Mg(SeO₄)₂·6H₂O, Cs₂Co(SeO₄)₂·6H₂O, etc.^[3]