Columnidin is an orange red pigment, belonging to the 3-deoxyanthocyanidins[1] found in red-flowered western-hemisphere gesneriad species such as episcias, columneas, sarmientas, and sinningias.
Quick facts Names, Identifiers ...
Columnidin
Chemical structure of columnidin |
Names |
IUPAC name
3′,4′,5,7,8-Pentahydroxyflavylium |
Preferred IUPAC name
2-(3,4-Dihydroxyphenyl)-5,7,8-trihydroxy-1λ4-benzopyran-1-ylium |
Identifiers |
|
|
ChemSpider |
|
|
|
|
|
InChI=1S/C15H10O6/c16-9-3-1-7(5-11(9)18)13-4-2-8-10(17)6-12(19)14(20)15(8)21-13/h1-6H,(H4-,16,17,18,19,20)/p+1 N Key: USQSSTLNPXPPHA-UHFFFAOYSA-O N InChI=1/C15H10O6/c16-9-3-1-7(5-11(9)18)13-4-2-8-10(17)6-12(19)14(20)15(8)21-13/h1-6H,(H4-,16,17,18,19,20)/p+1 Key: USQSSTLNPXPPHA-IKLDFBCSAT
|
C1=CC(=C(C=C1C2=[O+]C3=C(C=C2)C(=CC(=C3O)O)O)O)O
|
Properties |
|
C15H11O6+ |
Molar mass |
287.244 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
The columnidin is named after the gesneriad genus Columnea in which it is found,[2] notably in Columnea hybrida.[3]