Combretol is an O-methylated flavonol, a type of flavonoid. It is the 3,7,3',4',5'-O-methylation of myricetin and can be extracted from Combretum quadrangulare[2] and from Rhodomyrtus tomentosa.[3]
Quick Facts Names, Identifiers ...
Combretol
 Chemical structure of combretol |
| Names |
| IUPAC name
5-Hydroxy-3,3′,4′,5′,7-pentamethoxyflavone |
Preferred IUPAC name
5-Hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one |
| Other names
3,7,3',4',5'-pentamethylmyricetin |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C20H20O8/c1-23-11-8-12(21)16-13(9-11)28-18(20(27-5)17(16)22)10-6-14(24-2)19(26-4)15(7-10)25-3/h6-9,21H,1-5H3 N Key: SUNUQCQIFHHEOW-UHFFFAOYSA-N N InChI=1/C20H20O8/c1-23-11-8-12(21)16-13(9-11)28-18(20(27-5)17(16)22)10-6-14(24-2)19(26-4)15(7-10)25-3/h6-9,21H,1-5H3 Key: SUNUQCQIFHHEOW-UHFFFAOYAT
|
COC1=CC(=C2C(=C1)OC(=C(C2=O)OC)C3=CC(=C(C(=C3)OC)OC)OC)O
|
| Properties |
|
C20H20O8 |
| Molar mass |
388.36 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
