Coprostane, also known as 5β-cholestane, is a sterane and a parent compound of a variety of steroid derivatives, such as ecdysone and coprostanol.[1]
Quick facts Names, Identifiers ...
Coprostane
 |
 |
| Names |
| IUPAC name
5β-Cholestane |
Systematic IUPAC name
(1R,3aS,3bR,5aS,9aS,9bS,11aR)-9a,11a-Dimethyl-1-[(2R)-6-methylheptan-2-yl]hexadecahydro-1H-cyclopenta[a]phenanthrene |
| Identifiers |
|
|
|
|
|
2051807 |
| ChEBI |
|
| ChemSpider |
|
|
|
| UNII |
|
InChI=1S/C27H48/c1-19(2)9-8-10-20(3)23-14-15-24-22-13-12-21-11-6-7-17-26(21,4)25(22)16-18-27(23,24)5/h19-25H,6-18H2,1-5H3/t20-,21+,22+,23-,24+,25+,26+,27-/m1/s1 Key: XIIAYQZJNBULGD-CJPSHIORSA-N
|
C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CCCC4)C)C
|
| Properties |
|
C27H48 |
| Molar mass |
372.681 g·mol−1 |
| Related compounds |
Related Stanols |
24-ethyl coprostanol coprostanol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close