Coutaric acid is a hydroxycinnamoyltartaric acid found in wine, pomace[1] and grape.[2] It is an ester formed from coumaric acid and tartaric acid.
Quick facts Names, Identifiers ...
Coutaric acid
 Chemical structure of coutaric acid |
| Names |
Preferred IUPAC name
(2R,3R)-2-Hydroxy-3-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}butanedioic acid |
| Other names
trans-coutaric acid
cis-coutaric acid
trans-p-Coumaroyltartaric acid
cis-p-coumaroyl-(+)-tartaric acid
trans-p-coumaroyl-(+)-tartaric acid
cis-Coumaroyl tartaric acidbr>trans-Coumaroyl tartaric acid |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C13H12O8/c14-8-4-1-7(2-5-8)3-6-9(15)21-11(13(19)20)10(16)12(17)18/h1-6,10-11,14,16H,(H,17,18)(H,19,20)/b6-3+/t10-,11-/m1/s1 N Key: INYJZRKTYXTZHP-NNPIPJJVSA-N N InChI=1/C13H12O8/c14-8-4-1-7(2-5-8)3-6-9(15)21-11(13(19)20)10(16)12(17)18/h1-6,10-11,14,16H,(H,17,18)(H,19,20)/b6-3+/t10-,11-/m1/s1 Key: INYJZRKTYXTZHP-NNPIPJJVBX
|
c1cc(ccc1/C=C/C(=O)O[C@H]([C@H](C(=O)O)O)C(=O)O)O
|
| Properties |
|
C13H12O8 |
| Molar mass |
296.231 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
