N,N′-Dimethylpropyleneurea (DMPU) is a cyclic urea sometimes used as a polar, aprotic organic solvent. Along with the dimethylethyleneurea, it was introduced as an analog of tetramethylurea.[2]
Quick facts Names, Identifiers ...
DMPU
 |
 |
Names |
Preferred IUPAC name
1,3-Dimethyl-1,3-diazinan-2-one [1] |
Other names
N,N′-Dimethyl-N,N′-trimethyleneurea N,N′-Dimethylpropyleneurea 1,3-Dimethyl-3,4,5,6-tetrahydro-2(1H)-pyrimidinone |
Identifiers |
|
|
|
|
Abbreviations |
DMPU |
ChEMBL |
|
ChemSpider |
|
ECHA InfoCard |
100.027.841 |
EC Number |
|
|
|
|
|
InChI=1S/C6H12N2O/c1-7-4-3-5-8(2)6(7)9/h3-5H2,1-2H3 Y Key: GUVUOGQBMYCBQP-UHFFFAOYSA-N Y InChI=1/C6H12N2O/c1-7-4-3-5-8(2)6(7)9/h3-5H2,1-2H3 Key: GUVUOGQBMYCBQP-UHFFFAOYAB
|
|
Properties |
|
C6H12N2O |
Molar mass |
128.175 g·mol−1 |
Density |
1.064 g/cm3 |
Melting point |
−20 °C; −4 °F; 253 K |
Boiling point |
246.5 °C (475.7 °F; 519.6 K) (Source) |
|
miscible |
|
1.4875-1.4895 |
Hazards |
GHS labelling: |
|
   |
|
Danger |
|
H302, H318, H361f |
|
P201, P202, P264, P270, P280, P281, P301+P312, P305+P351+P338, P308+P313, P310, P330, P405, P501 |
Flash point |
121 °C (250 °F; 394 K) |
Safety data sheet (SDS) |
External MSDS |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
In 1985, Dieter Seebach showed that it is possible to replace the suspected carcinogen hexamethylphosphoramide (HMPA) with DMPU.[3]